C30H47N6O12S+ — CID 123666131
2-[[2-[[5-(2,5-dihydroxypyrrol-1-yl)oxy-5-oxopentanoyl]amino]-6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoyl]amino]ethyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 123666131) has the molecular formula C30H47N6O12S+ and a molecular weight of 715.80 g/mol. Its IUPAC name is 2-[[2-[[5-(2,5-dihydroxypyrrol-1-yl)oxy-5-oxopentanoyl]amino]-6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoyl]amino]ethyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 2-[[2-[[5-(2,5-dihydroxypyrrol-1-yl)oxy-5-oxopentanoyl]amino]-6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoyl]amino]ethyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 123666131 |
| Molecular Formula | C30H47N6O12S+ |
| Molecular Weight | 715.80 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | 2-[[2-[[5-(2,5-dihydroxypyrrol-1-yl)oxy-5-oxopentanoyl]amino]-6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoyl]amino]ethyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCS(=O)(=O)O)CCNC(=O)C(CCCCNC(=O)CCCN1C(=O)C=CC1=O)NC(=O)CCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C30H46N6O12S/c1-36(2,19-7-21-49(45,46)47)20-17-32-30(44)22(33-24(38)9-5-11-29(43)48-35-27(41)14-15-28(35)42)8-3-4-16-31-23(37)10-6-18-34-25(39)12-13-26(34)40/h12-15,22H,3-11,16-21H2,1-2H3,(H5-,31,32,33,37,38,39,40,41,42,44,45,46,47)/p+1 |
| InChIKey | IVKPMUKXZLXVLO-UHFFFAOYSA-O |
| XLogP | -1.03 |
| TPSA | 250.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.80 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|