C16H25N3O8S — CID 123569595
1-[3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 123569595) has the molecular formula C16H25N3O8S and a molecular weight of 419.46 g/mol. Its IUPAC name is 1-[3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 123569595 |
| Molecular Formula | C16H25N3O8S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-[3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | CC1CCCC(C)N1CC(=O)NCCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C16H25N3O8S/c1-10-4-3-5-11(2)18(10)9-13(20)17-7-6-15(22)27-19-14(21)8-12(16(19)23)28(24,25)26/h8,10-11,21,23H,3-7,9H2,1-2H3,(H,17,20)(H,24,25,26) |
| InChIKey | LSBKEHNAFXJSKG-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 158.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|