C14H18N4O8S — CID 123780734
(2,5-dihydroxypyrrol-1-yl) 2-[[2-[[2-[(2-acetylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate (PubChem CID 123780734) has the molecular formula C14H18N4O8S and a molecular weight of 402.39 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[[2-[[2-[(2-acetylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[[2-[[2-[(2-acetylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 123780734 |
| Molecular Formula | C14H18N4O8S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[[2-[[2-[(2-acetylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate |
| SMILES | CC(=O)SCC(=O)NCC(=O)NCC(=O)NCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C14H18N4O8S/c1-8(19)27-7-11(22)16-5-9(20)15-4-10(21)17-6-14(25)26-18-12(23)2-3-13(18)24/h2-3,23-24H,4-7H2,1H3,(H,15,20)(H,16,22)(H,17,21) |
| InChIKey | QLCCUCXWTQAIOM-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 176.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|