C8H9BrN2O5 — CID 54488983
(2,5-dihydroxypyrrol-1-yl) 2-[(2-bromoacetyl)amino]acetate (PubChem CID 54488983) has the molecular formula C8H9BrN2O5 and a molecular weight of 293.07 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[(2-bromoacetyl)amino]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[(2-bromoacetyl)amino]acetate |
|---|---|
| PubChem CID | 54488983 |
| Molecular Formula | C8H9BrN2O5 |
| Molecular Weight | 293.07 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[(2-bromoacetyl)amino]acetate |
| SMILES | O=C(CBr)NCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C8H9BrN2O5/c9-3-5(12)10-4-8(15)16-11-6(13)1-2-7(11)14/h1-2,13-14H,3-4H2,(H,10,12) |
| InChIKey | XUKBLXLCUJYFNV-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.07 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|