C20H31N3O8S2 — CID 57009433
2-acetamido-3-[1-(2-acetamido-2-carboxyethyl)sulfanyl-6-(2,5-dihydroxypyrrol-1-yl)hexyl]sulfanylpropanoic acid (PubChem CID 57009433) has the molecular formula C20H31N3O8S2 and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-acetamido-3-[1-(2-acetamido-2-carboxyethyl)sulfanyl-6-(2,5-dihydroxypyrrol-1-yl)hexyl]sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-[1-(2-acetamido-2-carboxyethyl)sulfanyl-6-(2,5-dihydroxypyrrol-1-yl)hexyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57009433 |
| Molecular Formula | C20H31N3O8S2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-acetamido-3-[1-(2-acetamido-2-carboxyethyl)sulfanyl-6-(2,5-dihydroxypyrrol-1-yl)hexyl]sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CSC(CCCCCn1c(O)ccc1O)SCC(NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H31N3O8S2/c1-12(24)21-14(19(28)29)10-32-18(33-11-15(20(30)31)22-13(2)25)6-4-3-5-9-23-16(26)7-8-17(23)27/h7-8,14-15,18,26-27H,3-6,9-11H2,1-2H3,(H,21,24)(H,22,25)(H,28,29)(H,30,31) |
| InChIKey | YQEDFNYCYGUYKO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 178.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|