C7H10N2O7S — CID 123179918
1-[(2S)-2-aminopropanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 123179918) has the molecular formula C7H10N2O7S and a molecular weight of 266.23 g/mol. Its IUPAC name is 1-[(2S)-2-aminopropanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[(2S)-2-aminopropanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 123179918 |
| Molecular Formula | C7H10N2O7S |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 1-[(2S)-2-aminopropanoyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | C[C@H](N)C(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C7H10N2O7S/c1-3(8)7(12)16-9-5(10)2-4(6(9)11)17(13,14)15/h2-3,10-11H,8H2,1H3,(H,13,14,15)/t3-/m0/s1 |
| InChIKey | NBTOHPBWZVACBX-VKHMYHEASA-N |
| XLogP | -1.55 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|