C5H5NO8S — CID 57112573
1-carboxyoxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 57112573) has the molecular formula C5H5NO8S and a molecular weight of 239.16 g/mol. Its IUPAC name is 1-carboxyoxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-carboxyoxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 57112573 |
| Molecular Formula | C5H5NO8S |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 1-carboxyoxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C5H5NO8S/c7-3-1-2(15(11,12)13)4(8)6(3)14-5(9)10/h1,7-8H,(H,9,10)(H,11,12,13) |
| InChIKey | ZDZUFDHTYPRBFK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|