C7H10N2O4S — CID 57140759
(2,5-dihydroxypyrrol-1-yl) (2R)-2-amino-3-sulfanylpropanoate (PubChem CID 57140759) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2R)-2-amino-3-sulfanylpropanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2R)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 57140759 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2R)-2-amino-3-sulfanylpropanoate |
| SMILES | N[C@@H](CS)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C7H10N2O4S/c8-4(3-14)7(12)13-9-5(10)1-2-6(9)11/h1-2,4,10-11,14H,3,8H2/t4-/m0/s1 |
| InChIKey | CCYUUWTTYROBLZ-BYPYZUCNSA-N |
| XLogP | -0.89 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|