C11H11F3N2O8S — CID 123953433
2,5-dihydroxy-1-[(2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl]oxypyrrole-3-sulfonic acid (PubChem CID 123953433) has the molecular formula C11H11F3N2O8S and a molecular weight of 388.28 g/mol. Its IUPAC name is 2,5-dihydroxy-1-[(2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl]oxypyrrole-3-sulfonic acid.
| Compound Name | 2,5-dihydroxy-1-[(2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl]oxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 123953433 |
| Molecular Formula | C11H11F3N2O8S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 2,5-dihydroxy-1-[(2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonyl]oxypyrrole-3-sulfonic acid |
| SMILES | O=C(On1c(O)cc(S(=O)(=O)O)c1O)[C@@H]1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O8S/c12-11(13,14)10(20)15-3-1-2-5(15)9(19)24-16-7(17)4-6(8(16)18)25(21,22)23/h4-5,17-18H,1-3H2,(H,21,22,23)/t5-/m0/s1 |
| InChIKey | SKFDDWQLVVTWSR-YFKPBYRVSA-N |
| XLogP | -0.35 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|