C14H18N2O9S — CID 91017069
1-[6-(2,5-dihydroxypyrrol-1-yl)hexanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91017069) has the molecular formula C14H18N2O9S and a molecular weight of 390.37 g/mol. Its IUPAC name is 1-[6-(2,5-dihydroxypyrrol-1-yl)hexanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[6-(2,5-dihydroxypyrrol-1-yl)hexanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91017069 |
| Molecular Formula | C14H18N2O9S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1-[6-(2,5-dihydroxypyrrol-1-yl)hexanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(CCCCCn1c(O)ccc1O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C14H18N2O9S/c17-10-5-6-11(18)15(10)7-3-1-2-4-13(20)25-16-12(19)8-9(14(16)21)26(22,23)24/h5-6,8,17-19,21H,1-4,7H2,(H,22,23,24) |
| InChIKey | JDODDFAMOIKIFU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 171.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|