C16H20N2O11S — CID 54278826
1,8-bis[(2,5-dihydroxypyrrol-1-yl)oxy]-1,8-dioxooctane-2-sulfonic acid (PubChem CID 54278826) has the molecular formula C16H20N2O11S and a molecular weight of 448.41 g/mol. Its IUPAC name is 1,8-bis[(2,5-dihydroxypyrrol-1-yl)oxy]-1,8-dioxooctane-2-sulfonic acid.
| Compound Name | 1,8-bis[(2,5-dihydroxypyrrol-1-yl)oxy]-1,8-dioxooctane-2-sulfonic acid |
|---|---|
| PubChem CID | 54278826 |
| Molecular Formula | C16H20N2O11S |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 1,8-bis[(2,5-dihydroxypyrrol-1-yl)oxy]-1,8-dioxooctane-2-sulfonic acid |
| SMILES | O=C(CCCCCC(C(=O)On1c(O)ccc1O)S(=O)(=O)O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H20N2O11S/c19-11-6-7-12(20)17(11)28-15(23)5-3-1-2-4-10(30(25,26)27)16(24)29-18-13(21)8-9-14(18)22/h6-10,19-22H,1-5H2,(H,25,26,27) |
| InChIKey | RPILTVBECDUARH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 197.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|