C19H26N2O8S — CID 123259840
1-[11-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfinic acid (PubChem CID 123259840) has the molecular formula C19H26N2O8S and a molecular weight of 442.49 g/mol. Its IUPAC name is 1-[11-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfinic acid.
| Compound Name | 1-[11-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfinic acid |
|---|---|
| PubChem CID | 123259840 |
| Molecular Formula | C19H26N2O8S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[11-(2,5-dioxopyrrol-1-yl)undecanoyloxy]-2,5-dihydroxypyrrole-3-sulfinic acid |
| SMILES | O=C(CCCCCCCCCCN1C(=O)C=CC1=O)On1c(O)cc(S(=O)O)c1O |
| InChI | InChI=1S/C19H26N2O8S/c22-15-10-11-16(23)20(15)12-8-6-4-2-1-3-5-7-9-18(25)29-21-17(24)13-14(19(21)26)30(27)28/h10-11,13,24,26H,1-9,12H2,(H,27,28) |
| InChIKey | FETHIJZQKXIYDT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|