C13H14N2O14S2 — CID 90951607
2-deuterio-2,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)pentanedioic acid (PubChem CID 90951607) has the molecular formula C13H14N2O14S2 and a molecular weight of 487.40 g/mol. Its IUPAC name is 2-deuterio-2,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)pentanedioic acid.
| Compound Name | 2-deuterio-2,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)pentanedioic acid |
|---|---|
| PubChem CID | 90951607 |
| Molecular Formula | C13H14N2O14S2 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | 2-deuterio-2,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)pentanedioic acid |
| SMILES | [2H]C(C(=O)O)(C(CC(=O)O)n1c(O)cc(S(=O)(=O)O)c1O)n1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C13H14N2O14S2/c16-7-2-5(30(24,25)26)11(20)14(7)4(1-9(18)19)10(13(22)23)15-8(17)3-6(12(15)21)31(27,28)29/h2-4,10,16-17,20-21H,1H2,(H,18,19)(H,22,23)(H,24,25,26)(H,27,28,29)/i10D |
| InChIKey | ILRNIEJTOIZGHR-MMIHMFRQSA-N |
| XLogP | -1.05 |
| TPSA | 274.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|