C12H12N2O14S2 — CID 123240932
2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)butanedioic acid (PubChem CID 123240932) has the molecular formula C12H12N2O14S2 and a molecular weight of 472.36 g/mol. Its IUPAC name is 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)butanedioic acid.
| Compound Name | 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)butanedioic acid |
|---|---|
| PubChem CID | 123240932 |
| Molecular Formula | C12H12N2O14S2 |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)(n1c(O)cc(S(=O)(=O)O)c1O)n1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C12H12N2O14S2/c15-6-1-4(29(23,24)25)9(19)13(6)12(11(21)22,3-8(17)18)14-7(16)2-5(10(14)20)30(26,27)28/h1-2,15-16,19-20H,3H2,(H,17,18)(H,21,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | XIRFPFPHRPSOQA-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 274.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|