C14H16N2O15S2 — CID 123615215
3,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)-4-(2-hydroxyethoxy)-4-oxobutanoic acid (PubChem CID 123615215) has the molecular formula C14H16N2O15S2 and a molecular weight of 516.42 g/mol. Its IUPAC name is 3,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)-4-(2-hydroxyethoxy)-4-oxobutanoic acid.
| Compound Name | 3,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)-4-(2-hydroxyethoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123615215 |
| Molecular Formula | C14H16N2O15S2 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | 3,3-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)-4-(2-hydroxyethoxy)-4-oxobutanoic acid |
| SMILES | O=C(O)CC(C(=O)OCCO)(n1c(O)cc(S(=O)(=O)O)c1O)n1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C14H16N2O15S2/c17-1-2-31-13(24)14(5-10(20)21,15-8(18)3-6(11(15)22)32(25,26)27)16-9(19)4-7(12(16)23)33(28,29)30/h3-4,17-19,22-23H,1-2,5H2,(H,20,21)(H,25,26,27)(H,28,29,30) |
| InChIKey | PZESAXAIJIROPT-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 283.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|