C18H20N2O18S2 — CID 54160979
4-[2-[3-carboxy-2-(2,5-dihydroxypyrrol-1-yl)-2-sulfopropanoyl]oxyethoxy]-3-(2,5-dihydroxypyrrol-1-yl)-4-oxo-3-sulfobutanoic acid (PubChem CID 54160979) has the molecular formula C18H20N2O18S2 and a molecular weight of 616.49 g/mol. Its IUPAC name is 4-[2-[3-carboxy-2-(2,5-dihydroxypyrrol-1-yl)-2-sulfopropanoyl]oxyethoxy]-3-(2,5-dihydroxypyrrol-1-yl)-4-oxo-3-sulfobutanoic acid.
| Compound Name | 4-[2-[3-carboxy-2-(2,5-dihydroxypyrrol-1-yl)-2-sulfopropanoyl]oxyethoxy]-3-(2,5-dihydroxypyrrol-1-yl)-4-oxo-3-sulfobutanoic acid |
|---|---|
| PubChem CID | 54160979 |
| Molecular Formula | C18H20N2O18S2 |
| Molecular Weight | 616.49 g/mol |
| Exact Mass | 616.02 |
| IUPAC Name | 4-[2-[3-carboxy-2-(2,5-dihydroxypyrrol-1-yl)-2-sulfopropanoyl]oxyethoxy]-3-(2,5-dihydroxypyrrol-1-yl)-4-oxo-3-sulfobutanoic acid |
| SMILES | O=C(O)CC(C(=O)OCCOC(=O)C(CC(=O)O)(n1c(O)ccc1O)S(=O)(=O)O)(n1c(O)ccc1O)S(=O)(=O)O |
| InChI | InChI=1S/C18H20N2O18S2/c21-9-1-2-10(22)19(9)17(7-13(25)26,39(31,32)33)15(29)37-5-6-38-16(30)18(8-14(27)28,40(34,35)36)20-11(23)3-4-12(20)24/h1-4,21-24H,5-8H2,(H,25,26)(H,27,28)(H,31,32,33)(H,34,35,36) |
| InChIKey | OOJMMHBLYYIWGO-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 326.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.49 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|