C8H9NO12S2 — CID 90742588
2-(2,5-dihydroxypyrrol-1-yl)-2,3-disulfobutanedioic acid (PubChem CID 90742588) has the molecular formula C8H9NO12S2 and a molecular weight of 375.29 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-2,3-disulfobutanedioic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-2,3-disulfobutanedioic acid |
|---|---|
| PubChem CID | 90742588 |
| Molecular Formula | C8H9NO12S2 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-2,3-disulfobutanedioic acid |
| SMILES | O=C(O)C(C(C(=O)O)(n1c(O)ccc1O)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C8H9NO12S2/c10-3-1-2-4(11)9(3)8(7(14)15,23(19,20)21)5(6(12)13)22(16,17)18/h1-2,5,10-11H,(H,12,13)(H,14,15)(H,16,17,18)(H,19,20,21) |
| InChIKey | FQXHODOSHXEHLQ-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 228.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|