C8H11NO4S2 — CID 57057447
3-(2,5-dihydroxypyrrol-1-yl)-4,4-bis(sulfanyl)butanoic acid (PubChem CID 57057447) has the molecular formula C8H11NO4S2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)-4,4-bis(sulfanyl)butanoic acid.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)-4,4-bis(sulfanyl)butanoic acid |
|---|---|
| PubChem CID | 57057447 |
| Molecular Formula | C8H11NO4S2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)-4,4-bis(sulfanyl)butanoic acid |
| SMILES | O=C(O)CC(C(S)S)n1c(O)ccc1O |
| InChI | InChI=1S/C8H11NO4S2/c10-5-1-2-6(11)9(5)4(8(14)15)3-7(12)13/h1-2,4,8,10-11,14-15H,3H2,(H,12,13) |
| InChIKey | GLVNCOOICVJBBE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|