C7H9NO10S4 — CID 56990741
3-(2,5-dihydroxypyrrol-1-yl)-2,2-bis(sulfanyl)-3,3-disulfopropanoic acid (PubChem CID 56990741) has the molecular formula C7H9NO10S4 and a molecular weight of 395.41 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)-2,2-bis(sulfanyl)-3,3-disulfopropanoic acid.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)-2,2-bis(sulfanyl)-3,3-disulfopropanoic acid |
|---|---|
| PubChem CID | 56990741 |
| Molecular Formula | C7H9NO10S4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 394.91 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)-2,2-bis(sulfanyl)-3,3-disulfopropanoic acid |
| SMILES | O=C(O)C(S)(S)C(n1c(O)ccc1O)(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C7H9NO10S4/c9-3-1-2-4(10)8(3)7(21(13,14)15,22(16,17)18)6(19,20)5(11)12/h1-2,9-10,19-20H,(H,11,12)(H,13,14,15)(H,16,17,18) |
| InChIKey | YUCLRLGQOJJAOL-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 191.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|