C6H7NO7S — CID 57285468
2-(2,5-dihydroxypyrrol-1-yl)-2-sulfoacetic acid (PubChem CID 57285468) has the molecular formula C6H7NO7S and a molecular weight of 237.19 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-2-sulfoacetic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-2-sulfoacetic acid |
|---|---|
| PubChem CID | 57285468 |
| Molecular Formula | C6H7NO7S |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-2-sulfoacetic acid |
| SMILES | O=C(O)C(n1c(O)ccc1O)S(=O)(=O)O |
| InChI | InChI=1S/C6H7NO7S/c8-3-1-2-4(9)7(3)5(6(10)11)15(12,13)14/h1-2,5,8-9H,(H,10,11)(H,12,13,14) |
| InChIKey | KHWNLNDYCCHOGI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|