C6H6BrNO4 — CID 54203655
2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid (PubChem CID 54203655) has the molecular formula C6H6BrNO4 and a molecular weight of 236.02 g/mol. Its IUPAC name is 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid.
| Compound Name | 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid |
|---|---|
| PubChem CID | 54203655 |
| Molecular Formula | C6H6BrNO4 |
| Molecular Weight | 236.02 g/mol |
| Exact Mass | 234.95 |
| IUPAC Name | 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid |
| SMILES | O=C(O)C(Br)n1c(O)ccc1O |
| InChI | InChI=1S/C6H6BrNO4/c7-5(6(11)12)8-3(9)1-2-4(8)10/h1-2,5,9-10H,(H,11,12) |
| InChIKey | PQZQSHAEVMYJOI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.02 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|