2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid

C6H6BrNO4 — CID 54203655

IUPAC2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid
SMILESO=C(O)C(Br)n1c(O)ccc1O
InChIInChI=1S/C6H6BrNO4/c7-5(6(11)12)8-3(9)1-2-4(8)10/h1-2,5,9-10H,(H,11,12)
InChIKeyPQZQSHAEVMYJOI-UHFFFAOYSA-N
MW236.02 g/mol
LogP0.88
Rot. Bonds2

About 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid

2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid (PubChem CID 54203655) has the molecular formula C6H6BrNO4 and a molecular weight of 236.02 g/mol. Its IUPAC name is 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid.

Molecular Properties

Compound Name2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid
PubChem CID54203655
Molecular FormulaC6H6BrNO4
Molecular Weight236.02 g/mol
Exact Mass234.95
IUPAC Name2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid
SMILESO=C(O)C(Br)n1c(O)ccc1O
InChIInChI=1S/C6H6BrNO4/c7-5(6(11)12)8-3(9)1-2-4(8)10/h1-2,5,9-10H,(H,11,12)
InChIKeyPQZQSHAEVMYJOI-UHFFFAOYSA-N
XLogP0.88
TPSA82.69 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.02
LogP ≤ 50.88
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid?
The IUPAC name of 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid (CID 54203655) is 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid.
What is the SMILES notation for 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid?
The canonical SMILES for 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid is O=C(O)C(Br)n1c(O)ccc1O.
What is the InChIKey of 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid?
The InChIKey is PQZQSHAEVMYJOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNO4/c7-5(6(11)12)8-3(9)1-2-4(8)10/h1-2,5,9-10H,(H,11,12).
What are the key properties of 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid?
2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid has a molecular weight of 236.02 g/mol, XLogP of 0.88, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-(2,5-dihydroxypyrrol-1-yl)acetic acid is sourced from PubChem (CID 54203655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).