C11H12N2O12S2 — CID 91545254
2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)propanoic acid (PubChem CID 91545254) has the molecular formula C11H12N2O12S2 and a molecular weight of 428.35 g/mol. Its IUPAC name is 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)propanoic acid.
| Compound Name | 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 91545254 |
| Molecular Formula | C11H12N2O12S2 |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)propanoic acid |
| SMILES | CC(C(=O)O)(n1c(O)cc(S(=O)(=O)O)c1O)n1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C11H12N2O12S2/c1-11(10(18)19,12-6(14)2-4(8(12)16)26(20,21)22)13-7(15)3-5(9(13)17)27(23,24)25/h2-3,14-17H,1H3,(H,18,19)(H,20,21,22)(H,23,24,25) |
| InChIKey | KFWLOZWMHCYSRY-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 236.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|