C11H12N2O13S2 — CID 91054532
methyl 1-(2,5-dihydroxy-3-methoxyperoxysulfanylpyrrol-1-yl)oxycarbonyloxy-2,5-dihydroxypyrrole-3-sulfonate (PubChem CID 91054532) has the molecular formula C11H12N2O13S2 and a molecular weight of 444.35 g/mol. Its IUPAC name is methyl 1-(2,5-dihydroxy-3-methoxyperoxysulfanylpyrrol-1-yl)oxycarbonyloxy-2,5-dihydroxypyrrole-3-sulfonate.
| Compound Name | methyl 1-(2,5-dihydroxy-3-methoxyperoxysulfanylpyrrol-1-yl)oxycarbonyloxy-2,5-dihydroxypyrrole-3-sulfonate |
|---|---|
| PubChem CID | 91054532 |
| Molecular Formula | C11H12N2O13S2 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | methyl 1-(2,5-dihydroxy-3-methoxyperoxysulfanylpyrrol-1-yl)oxycarbonyloxy-2,5-dihydroxypyrrole-3-sulfonate |
| SMILES | COOOSc1cc(O)n(OC(=O)On2c(O)cc(S(=O)(=O)OC)c2O)c1O |
| InChI | InChI=1S/C11H12N2O13S2/c1-21-25-26-27-5-3-7(14)12(9(5)16)23-11(18)24-13-8(15)4-6(10(13)17)28(19,20)22-2/h3-4,14-17H,1-2H3 |
| InChIKey | VSDANUUHRHCPEZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 197.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|