C12H14N2O9S — CID 91325870
1-[4-(2,5-dihydroxypyrrol-1-yl)butanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91325870) has the molecular formula C12H14N2O9S and a molecular weight of 362.32 g/mol. Its IUPAC name is 1-[4-(2,5-dihydroxypyrrol-1-yl)butanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[4-(2,5-dihydroxypyrrol-1-yl)butanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91325870 |
| Molecular Formula | C12H14N2O9S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 1-[4-(2,5-dihydroxypyrrol-1-yl)butanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(CCCn1c(O)ccc1O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C12H14N2O9S/c15-8-3-4-9(16)13(8)5-1-2-11(18)23-14-10(17)6-7(12(14)19)24(20,21)22/h3-4,6,15-17,19H,1-2,5H2,(H,20,21,22) |
| InChIKey | BXURFPLENIPIBM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 171.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|