C18H24N2O8 — CID 91261020
2,2-bis(2,5-dihydroxypyrrol-1-yl)decanedioic acid (PubChem CID 91261020) has the molecular formula C18H24N2O8 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2,2-bis(2,5-dihydroxypyrrol-1-yl)decanedioic acid.
| Compound Name | 2,2-bis(2,5-dihydroxypyrrol-1-yl)decanedioic acid |
|---|---|
| PubChem CID | 91261020 |
| Molecular Formula | C18H24N2O8 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2,2-bis(2,5-dihydroxypyrrol-1-yl)decanedioic acid |
| SMILES | O=C(O)CCCCCCCC(C(=O)O)(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C18H24N2O8/c21-12-7-8-13(22)19(12)18(17(27)28,20-14(23)9-10-15(20)24)11-5-3-1-2-4-6-16(25)26/h7-10,21-24H,1-6,11H2,(H,25,26)(H,27,28) |
| InChIKey | KAXJIMAKWPXCDM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|