C16H24F3NO7S — CID 91232631
(2,5-dihydroxypyrrol-1-yl) 11-(trifluoromethylsulfonyloxy)undecanoate (PubChem CID 91232631) has the molecular formula C16H24F3NO7S and a molecular weight of 431.43 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 11-(trifluoromethylsulfonyloxy)undecanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 11-(trifluoromethylsulfonyloxy)undecanoate |
|---|---|
| PubChem CID | 91232631 |
| Molecular Formula | C16H24F3NO7S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 11-(trifluoromethylsulfonyloxy)undecanoate |
| SMILES | O=C(CCCCCCCCCCOS(=O)(=O)C(F)(F)F)On1c(O)ccc1O |
| InChI | InChI=1S/C16H24F3NO7S/c17-16(18,19)28(24,25)26-12-8-6-4-2-1-3-5-7-9-15(23)27-20-13(21)10-11-14(20)22/h10-11,21-22H,1-9,12H2 |
| InChIKey | VNFIVLQBSXEABO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|