C7H7NO10S4 — CID 91209341
(7,9-dihydroxy-1,1,6,6-tetraoxo-[1,4,2,3,5,8]dioxatetrathiocino[6,7-c]pyrrol-8-yl) propanoate (PubChem CID 91209341) has the molecular formula C7H7NO10S4 and a molecular weight of 393.40 g/mol. Its IUPAC name is (7,9-dihydroxy-1,1,6,6-tetraoxo-[1,4,2,3,5,8]dioxatetrathiocino[6,7-c]pyrrol-8-yl) propanoate.
| Compound Name | (7,9-dihydroxy-1,1,6,6-tetraoxo-[1,4,2,3,5,8]dioxatetrathiocino[6,7-c]pyrrol-8-yl) propanoate |
|---|---|
| PubChem CID | 91209341 |
| Molecular Formula | C7H7NO10S4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | (7,9-dihydroxy-1,1,6,6-tetraoxo-[1,4,2,3,5,8]dioxatetrathiocino[6,7-c]pyrrol-8-yl) propanoate |
| SMILES | CCC(=O)On1c(O)c2c(c1O)S(=O)(=O)OSSOS2(=O)=O |
| InChI | InChI=1S/C7H7NO10S4/c1-2-3(9)16-8-6(10)4-5(7(8)11)22(14,15)18-20-19-17-21(4,12)13/h10-11H,2H2,1H3 |
| InChIKey | IJXFQGNPRSOZFJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|