C7H9NO7S — CID 91582119
(2,5-dihydroxy-3-methoxysulfonylpyrrol-1-yl) acetate (PubChem CID 91582119) has the molecular formula C7H9NO7S and a molecular weight of 251.22 g/mol. Its IUPAC name is (2,5-dihydroxy-3-methoxysulfonylpyrrol-1-yl) acetate.
| Compound Name | (2,5-dihydroxy-3-methoxysulfonylpyrrol-1-yl) acetate |
|---|---|
| PubChem CID | 91582119 |
| Molecular Formula | C7H9NO7S |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | (2,5-dihydroxy-3-methoxysulfonylpyrrol-1-yl) acetate |
| SMILES | COS(=O)(=O)c1cc(O)n(OC(C)=O)c1O |
| InChI | InChI=1S/C7H9NO7S/c1-4(9)15-8-6(10)3-5(7(8)11)16(12,13)14-2/h3,10-11H,1-2H3 |
| InChIKey | LSZOOCACPSEMDN-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|