C7H9F2NO5S — CID 123978946
(2,5-dihydroxypyrrol-1-yl) 1,1-difluoropropane-1-sulfonate (PubChem CID 123978946) has the molecular formula C7H9F2NO5S and a molecular weight of 257.21 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 1,1-difluoropropane-1-sulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 1,1-difluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 123978946 |
| Molecular Formula | C7H9F2NO5S |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 1,1-difluoropropane-1-sulfonate |
| SMILES | CCC(F)(F)S(=O)(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C7H9F2NO5S/c1-2-7(8,9)16(13,14)15-10-5(11)3-4-6(10)12/h3-4,11-12H,2H2,1H3 |
| InChIKey | RZUCPGHLPFZKCB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |