C5H4F3NO5S — CID 54270690
(2,5-dihydroxypyrrol-1-yl) trifluoromethanesulfonate (PubChem CID 54270690) has the molecular formula C5H4F3NO5S and a molecular weight of 247.15 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) trifluoromethanesulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54270690 |
| Molecular Formula | C5H4F3NO5S |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(On1c(O)ccc1O)C(F)(F)F |
| InChI | InChI=1S/C5H4F3NO5S/c6-5(7,8)15(12,13)14-9-3(10)1-2-4(9)11/h1-2,10-11H |
| InChIKey | RJWUPCBOOVWVTH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|