About (2,5-dihydroxypyrrol-1-yl) formate
(2,5-dihydroxypyrrol-1-yl) formate (PubChem CID 54439148) has the molecular formula C5H5NO4
and a molecular weight of 143.10 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) formate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) formate |
| PubChem CID | 54439148 |
| Molecular Formula | C5H5NO4 |
| Molecular Weight | 143.10 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) formate |
| SMILES | O=COn1c(O)ccc1O |
| InChI | InChI=1S/C5H5NO4/c7-3-10-6-4(8)1-2-5(6)9/h1-3,8-9H |
| InChIKey | ZRUJRPFDWOLKLV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.10 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) formate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) formate (CID 54439148) is (2,5-dihydroxypyrrol-1-yl) formate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) formate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) formate is O=COn1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) formate?
The InChIKey is ZRUJRPFDWOLKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO4/c7-3-10-6-4(8)1-2-5(6)9/h1-3,8-9H.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) formate?
(2,5-dihydroxypyrrol-1-yl) formate has a molecular weight of 143.10 g/mol, XLogP of -0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) formate is sourced from PubChem (CID 54439148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).