C5H7NO6S — CID 56982909
1,2,5-trihydroxy-4-methylpyrrole-3-sulfonic acid (PubChem CID 56982909) has the molecular formula C5H7NO6S and a molecular weight of 209.18 g/mol. Its IUPAC name is 1,2,5-trihydroxy-4-methylpyrrole-3-sulfonic acid.
| Compound Name | 1,2,5-trihydroxy-4-methylpyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 56982909 |
| Molecular Formula | C5H7NO6S |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 1,2,5-trihydroxy-4-methylpyrrole-3-sulfonic acid |
| SMILES | Cc1c(S(=O)(=O)O)c(O)n(O)c1O |
| InChI | InChI=1S/C5H7NO6S/c1-2-3(13(10,11)12)5(8)6(9)4(2)7/h7-9H,1H3,(H,10,11,12) |
| InChIKey | YEZZVVFBXXXPCX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|