C7H8F3NO5S — CID 91561493
(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl) trifluoromethanesulfonate (PubChem CID 91561493) has the molecular formula C7H8F3NO5S and a molecular weight of 275.20 g/mol. Its IUPAC name is (2,5-dihydroxy-3,4-dimethylpyrrol-1-yl) trifluoromethanesulfonate.
| Compound Name | (2,5-dihydroxy-3,4-dimethylpyrrol-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91561493 |
| Molecular Formula | C7H8F3NO5S |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (2,5-dihydroxy-3,4-dimethylpyrrol-1-yl) trifluoromethanesulfonate |
| SMILES | Cc1c(C)c(O)n(OS(=O)(=O)C(F)(F)F)c1O |
| InChI | InChI=1S/C7H8F3NO5S/c1-3-4(2)6(13)11(5(3)12)16-17(14,15)7(8,9)10/h12-13H,1-2H3 |
| InChIKey | ZQYNABIOMHUAPM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|