C9H9F6NO3 — CID 91287767
1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91287767) has the molecular formula C9H9F6NO3 and a molecular weight of 293.16 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91287767 |
| Molecular Formula | C9H9F6NO3 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(C(O)(C(F)(F)F)C(F)(F)F)c1O |
| InChI | InChI=1S/C9H9F6NO3/c1-3-4(2)6(18)16(5(3)17)7(19,8(10,11)12)9(13,14)15/h17-19H,1-2H3 |
| InChIKey | UMDBWNXNLSNGEZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |