C8H10F3NO2 — CID 90855816
3,4-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-2,5-diol (PubChem CID 90855816) has the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. Its IUPAC name is 3,4-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-2,5-diol.
| Compound Name | 3,4-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90855816 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 3,4-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(CC(F)(F)F)c1O |
| InChI | InChI=1S/C8H10F3NO2/c1-4-5(2)7(14)12(6(4)13)3-8(9,10)11/h13-14H,3H2,1-2H3 |
| InChIKey | SBVFUJCOLVACRE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |