C7H8F3NO2 — CID 90883535
3,4-dimethyl-1-(trifluoromethyl)pyrrole-2,5-diol (PubChem CID 90883535) has the molecular formula C7H8F3NO2 and a molecular weight of 195.14 g/mol. Its IUPAC name is 3,4-dimethyl-1-(trifluoromethyl)pyrrole-2,5-diol.
| Compound Name | 3,4-dimethyl-1-(trifluoromethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90883535 |
| Molecular Formula | C7H8F3NO2 |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3,4-dimethyl-1-(trifluoromethyl)pyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(C(F)(F)F)c1O |
| InChI | InChI=1S/C7H8F3NO2/c1-3-4(2)6(13)11(5(3)12)7(8,9)10/h12-13H,1-2H3 |
| InChIKey | NXEOIHXRIZVHIT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |