C9H11NO2 — CID 91057267
3,4-bis(ethenyl)-1-methylpyrrole-2,5-diol (PubChem CID 91057267) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-1-methylpyrrole-2,5-diol.
| Compound Name | 3,4-bis(ethenyl)-1-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91057267 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3,4-bis(ethenyl)-1-methylpyrrole-2,5-diol |
| SMILES | C=Cc1c(C=C)c(O)n(C)c1O |
| InChI | InChI=1S/C9H11NO2/c1-4-6-7(5-2)9(12)10(3)8(6)11/h4-5,11-12H,1-2H2,3H3 |
| InChIKey | OXCPZXKHRVILBW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |