C7H9NO2 — CID 91549041
3-ethenyl-4-methyl-1H-pyrrole-2,5-diol (PubChem CID 91549041) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-ethenyl-4-methyl-1H-pyrrole-2,5-diol.
| Compound Name | 3-ethenyl-4-methyl-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91549041 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-ethenyl-4-methyl-1H-pyrrole-2,5-diol |
| SMILES | C=Cc1c(O)[nH]c(O)c1C |
| InChI | InChI=1S/C7H9NO2/c1-3-5-4(2)6(9)8-7(5)10/h3,8-10H,1H2,2H3 |
| InChIKey | IJSYSILXNBZBGI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |