C10H9NO2 — CID 54149270
4,7-dimethylidene-2H-isoindole-1,3-diol (PubChem CID 54149270) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 4,7-dimethylidene-2H-isoindole-1,3-diol.
| Compound Name | 4,7-dimethylidene-2H-isoindole-1,3-diol |
|---|---|
| PubChem CID | 54149270 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4,7-dimethylidene-2H-isoindole-1,3-diol |
| SMILES | C=c1ccc(=C)c2c(O)[nH]c(O)c12 |
| InChI | InChI=1S/C10H9NO2/c1-5-3-4-6(2)8-7(5)9(12)11-10(8)13/h3-4,11-13H,1-2H2 |
| InChIKey | OGPGGTVERSNSCA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |