C14H19NO2 — CID 90872933
8-methyl-10-propan-2-yl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol (PubChem CID 90872933) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 8-methyl-10-propan-2-yl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol.
| Compound Name | 8-methyl-10-propan-2-yl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 90872933 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 8-methyl-10-propan-2-yl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
| SMILES | CC1=CC2c3c(O)[nH]c(O)c3C1CC2C(C)C |
| InChI | InChI=1S/C14H19NO2/c1-6(2)8-5-9-7(3)4-10(8)12-11(9)13(16)15-14(12)17/h4,6,8-10,15-17H,5H2,1-3H3 |
| InChIKey | AJTLECQAMZQZLS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|