C14H17NO4 — CID 91135938
(3,5-dihydroxy-8,11-dimethyl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-1-yl) acetate (PubChem CID 91135938) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (3,5-dihydroxy-8,11-dimethyl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-1-yl) acetate.
| Compound Name | (3,5-dihydroxy-8,11-dimethyl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-1-yl) acetate |
|---|---|
| PubChem CID | 91135938 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (3,5-dihydroxy-8,11-dimethyl-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-1-yl) acetate |
| SMILES | CC(=O)OC12C=C(C)C(c3c(O)[nH]c(O)c31)C(C)C2 |
| InChI | InChI=1S/C14H17NO4/c1-6-4-14(19-8(3)16)5-7(2)9(6)10-11(14)13(18)15-12(10)17/h4,7,9,15,17-18H,5H2,1-3H3 |
| InChIKey | FSXWFLGRZUURPZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|