C8H11NO2 — CID 90781057
3-ethenyl-1-(114C)ethylpyrrole-2,5-diol (PubChem CID 90781057) has the molecular formula C8H11NO2 and a molecular weight of 155.17 g/mol. Its IUPAC name is 3-ethenyl-1-(114C)ethylpyrrole-2,5-diol.
| Compound Name | 3-ethenyl-1-(114C)ethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 90781057 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3-ethenyl-1-(114C)ethylpyrrole-2,5-diol |
| SMILES | C=Cc1cc(O)n([14CH2]C)c1O |
| InChI | InChI=1S/C8H11NO2/c1-3-6-5-7(10)9(4-2)8(6)11/h3,5,10-11H,1,4H2,2H3/i4+2 |
| InChIKey | DRNDJCATVFFHCG-DOMIDYPGSA-N |
| XLogP | 1.56 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |