C6H8ClNO2 — CID 91100060
1-chloro-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91100060) has the molecular formula C6H8ClNO2 and a molecular weight of 161.59 g/mol. Its IUPAC name is 1-chloro-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-chloro-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91100060 |
| Molecular Formula | C6H8ClNO2 |
| Molecular Weight | 161.59 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | 1-chloro-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(Cl)c1O |
| InChI | InChI=1S/C6H8ClNO2/c1-3-4(2)6(10)8(7)5(3)9/h9-10H,1-2H3 |
| InChIKey | BCBVFNNSQILRPA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |