C7H11NO3 — CID 54194747
1-(hydroxymethyl)-3,4-dimethylpyrrole-2,5-diol (PubChem CID 54194747) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-(hydroxymethyl)-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54194747 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-(hydroxymethyl)-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(CO)c1O |
| InChI | InChI=1S/C7H11NO3/c1-4-5(2)7(11)8(3-9)6(4)10/h9-11H,3H2,1-2H3 |
| InChIKey | PLABDTSAIGPGJD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |