C12H21NO2 — CID 90750204
1-(3,3-dimethylbutyl)-3,4-dimethylpyrrole-2,5-diol (PubChem CID 90750204) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-(3,3-dimethylbutyl)-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 90750204 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(CCC(C)(C)C)c1O |
| InChI | InChI=1S/C12H21NO2/c1-8-9(2)11(15)13(10(8)14)7-6-12(3,4)5/h14-15H,6-7H2,1-5H3 |
| InChIKey | DUCZKTYXUNCDKJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |