C8H13NO3 — CID 91300917
1-(2-hydroxyethyl)-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91300917) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-(2-hydroxyethyl)-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91300917 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(CCO)c1O |
| InChI | InChI=1S/C8H13NO3/c1-5-6(2)8(12)9(3-4-10)7(5)11/h10-12H,3-4H2,1-2H3 |
| InChIKey | KQSADJQCTVVAKV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |