C9H15NO2 — CID 90900019
3-methyl-1-(2-methylpropyl)pyrrole-2,5-diol (PubChem CID 90900019) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 3-methyl-1-(2-methylpropyl)pyrrole-2,5-diol.
| Compound Name | 3-methyl-1-(2-methylpropyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90900019 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 3-methyl-1-(2-methylpropyl)pyrrole-2,5-diol |
| SMILES | Cc1cc(O)n(CC(C)C)c1O |
| InChI | InChI=1S/C9H15NO2/c1-6(2)5-10-8(11)4-7(3)9(10)12/h4,6,11-12H,5H2,1-3H3 |
| InChIKey | WXYXHPZAOCKTAM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |