C7H11NO3 — CID 91357511
1-methoxy-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91357511) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 1-methoxy-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-methoxy-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91357511 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-methoxy-3,4-dimethylpyrrole-2,5-diol |
| SMILES | COn1c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C7H11NO3/c1-4-5(2)7(10)8(11-3)6(4)9/h9-10H,1-3H3 |
| InChIKey | IBKGAABXFYJIFK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |