About 1-hydroxy-3,4-dimethylpyrrol-2-ol
1-hydroxy-3,4-dimethylpyrrol-2-ol (PubChem CID 171393951) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 1-hydroxy-3,4-dimethylpyrrol-2-ol.
Molecular Properties
| Compound Name | 1-hydroxy-3,4-dimethylpyrrol-2-ol |
| PubChem CID | 171393951 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 1-hydroxy-3,4-dimethylpyrrol-2-ol |
| SMILES | Cc1cn(O)c(O)c1C |
| InChI | InChI=1S/C6H9NO2/c1-4-3-7(9)6(8)5(4)2/h3,8-9H,1-2H3 |
| InChIKey | HOJAYMZMFFJBGK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3,4-dimethylpyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,4-dimethylpyrrol-2-ol?
The IUPAC name of 1-hydroxy-3,4-dimethylpyrrol-2-ol (CID 171393951) is 1-hydroxy-3,4-dimethylpyrrol-2-ol.
What is the SMILES notation for 1-hydroxy-3,4-dimethylpyrrol-2-ol?
The canonical SMILES for 1-hydroxy-3,4-dimethylpyrrol-2-ol is Cc1cn(O)c(O)c1C.
What is the InChIKey of 1-hydroxy-3,4-dimethylpyrrol-2-ol?
The InChIKey is HOJAYMZMFFJBGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-3-7(9)6(8)5(4)2/h3,8-9H,1-2H3.
What are the key properties of 1-hydroxy-3,4-dimethylpyrrol-2-ol?
1-hydroxy-3,4-dimethylpyrrol-2-ol has a molecular weight of 127.14 g/mol, XLogP of 1.05, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,4-dimethylpyrrol-2-ol is sourced from PubChem (CID 171393951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).