C8H13NO2 — CID 91502885
1-ethyl-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91502885) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 1-ethyl-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-ethyl-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91502885 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 1-ethyl-3,4-dimethylpyrrole-2,5-diol |
| SMILES | CCn1c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C8H13NO2/c1-4-9-7(10)5(2)6(3)8(9)11/h10-11H,4H2,1-3H3 |
| InChIKey | IXONXGJVIUDTEV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |